C10H20N2 — CID 142236043
(2R,4Z)-6-N,2,5-trimethylhepta-4,6-diene-1,6-diamine (PubChem CID 142236043) has the molecular formula C10H20N2 and a molecular weight of 168.28 g/mol. Its IUPAC name is (2R,4Z)-6-N,2,5-trimethylhepta-4,6-diene-1,6-diamine.
| Compound Name | (2R,4Z)-6-N,2,5-trimethylhepta-4,6-diene-1,6-diamine |
|---|---|
| PubChem CID | 142236043 |
| Molecular Formula | C10H20N2 |
| Molecular Weight | 168.28 g/mol |
| Exact Mass | 168.16 |
| IUPAC Name | (2R,4Z)-6-N,2,5-trimethylhepta-4,6-diene-1,6-diamine |
| SMILES | C=C(NC)/C(C)=C\C[C@@H](C)CN |
| InChI | InChI=1S/C10H20N2/c1-8(7-11)5-6-9(2)10(3)12-4/h6,8,12H,3,5,7,11H2,1-2,4H3/b9-6-/t8-/m1/s1 |
| InChIKey | QLRDBGUHIIKGEV-WSQKDGNHSA-N |
| XLogP | 1.65 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.28 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|