C13H23F3N4 — CID 155306417
(1E,3Z)-3-N-(3-aminopropyl)-6-methyl-2-(trifluoromethyl)octa-1,3,7-triene-1,3,7-triamine (PubChem CID 155306417) has the molecular formula C13H23F3N4 and a molecular weight of 292.35 g/mol. Its IUPAC name is (1E,3Z)-3-N-(3-aminopropyl)-6-methyl-2-(trifluoromethyl)octa-1,3,7-triene-1,3,7-triamine.
| Compound Name | (1E,3Z)-3-N-(3-aminopropyl)-6-methyl-2-(trifluoromethyl)octa-1,3,7-triene-1,3,7-triamine |
|---|---|
| PubChem CID | 155306417 |
| Molecular Formula | C13H23F3N4 |
| Molecular Weight | 292.35 g/mol |
| Exact Mass | 292.19 |
| IUPAC Name | (1E,3Z)-3-N-(3-aminopropyl)-6-methyl-2-(trifluoromethyl)octa-1,3,7-triene-1,3,7-triamine |
| SMILES | C=C(N)C(C)C/C=C(NCCCN)/C(=C\N)C(F)(F)F |
| InChI | InChI=1S/C13H23F3N4/c1-9(10(2)19)4-5-12(20-7-3-6-17)11(8-18)13(14,15)16/h5,8-9,20H,2-4,6-7,17-19H2,1H3/b11-8+,12-5- |
| InChIKey | MGROJCVXONMGIC-WAWFYLEGSA-N |
| XLogP | 1.71 |
| TPSA | 90.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.35 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|