C30H35NS2 — CID 142236057
(1E,3E,5Z)-4-ethenyl-N-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-5-methylsulfanyl-N-[(3E,5E)-6-(2H-thiopyran-3-yl)hepta-1,3,5-trien-3-yl]octa-1,3,5,7-tetraen-1-amine (PubChem CID 142236057) has the molecular formula C30H35NS2 and a molecular weight of 473.75 g/mol. Its IUPAC name is (1E,3E,5Z)-4-ethenyl-N-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-5-methylsulfanyl-N-[(3E,5E)-6-(2H-thiopyran-3-yl)hepta-1,3,5-trien-3-yl]octa-1,3,5,7-tetraen-1-amine.
| Compound Name | (1E,3E,5Z)-4-ethenyl-N-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-5-methylsulfanyl-N-[(3E,5E)-6-(2H-thiopyran-3-yl)hepta-1,3,5-trien-3-yl]octa-1,3,5,7-tetraen-1-amine |
|---|---|
| PubChem CID | 142236057 |
| Molecular Formula | C30H35NS2 |
| Molecular Weight | 473.75 g/mol |
| Exact Mass | 473.22 |
| IUPAC Name | (1E,3E,5Z)-4-ethenyl-N-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-5-methylsulfanyl-N-[(3E,5E)-6-(2H-thiopyran-3-yl)hepta-1,3,5-trien-3-yl]octa-1,3,5,7-tetraen-1-amine |
| SMILES | C=C/C=C(SC)/C(C=C)=C/C=C/N(/C(C=C)=C/C=C(\C)C1=CC=CSC1)C(/C=C\C)=C/C=C |
| InChI | InChI=1S/C30H35NS2/c1-8-15-29(16-9-2)31(22-13-18-26(11-4)30(32-7)17-10-3)28(12-5)21-20-25(6)27-19-14-23-33-24-27/h8-23H,1,3-5,24H2,2,6-7H3/b16-9-,22-13+,25-20+,26-18+,28-21+,29-15+,30-17- |
| InChIKey | BXKVWXSORTWTAW-VVANMKMJSA-N |
| XLogP | 9.20 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.75 |
| LogP ≤ 5 | 9.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|