C30H43N3O4S — CID 142242214
N-[3-(2-butyl-1-oxo-3,4-dihydro-2H-thiophen-1-yl)-1-[[3-[(3-ethylphenyl)methylamino]-2-hydroxypropyl]amino]-1-oxopropan-2-yl]benzamide (PubChem CID 142242214) has the molecular formula C30H43N3O4S and a molecular weight of 541.76 g/mol. Its IUPAC name is N-[3-(2-butyl-1-oxo-3,4-dihydro-2H-thiophen-1-yl)-1-[[3-[(3-ethylphenyl)methylamino]-2-hydroxypropyl]amino]-1-oxopropan-2-yl]benzamide.
| Compound Name | N-[3-(2-butyl-1-oxo-3,4-dihydro-2H-thiophen-1-yl)-1-[[3-[(3-ethylphenyl)methylamino]-2-hydroxypropyl]amino]-1-oxopropan-2-yl]benzamide |
|---|---|
| PubChem CID | 142242214 |
| Molecular Formula | C30H43N3O4S |
| Molecular Weight | 541.76 g/mol |
| Exact Mass | 541.30 |
| IUPAC Name | N-[3-(2-butyl-1-oxo-3,4-dihydro-2H-thiophen-1-yl)-1-[[3-[(3-ethylphenyl)methylamino]-2-hydroxypropyl]amino]-1-oxopropan-2-yl]benzamide |
| SMILES | CCCCC1CCC=S1(=O)CC(NC(=O)c1ccccc1)C(=O)NCC(O)CNCc1cccc(CC)c1 |
| InChI | InChI=1S/C30H43N3O4S/c1-3-5-15-27-16-10-17-38(27,37)22-28(33-29(35)25-13-7-6-8-14-25)30(36)32-21-26(34)20-31-19-24-12-9-11-23(4-2)18-24/h6-9,11-14,17-18,26-28,31,34H,3-5,10,15-16,19-22H2,1-2H3,(H,32,36)(H,33,35) |
| InChIKey | GGXAMGAIZWPVDR-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 107.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.76 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|