C18H19Cl2N5S — CID 142245227
[5-(3,4-dichlorophenyl)-2-methylsulfanyl-6-pyridin-4-ylpyrimidin-4-yl]hydrazine;ethane (PubChem CID 142245227) has the molecular formula C18H19Cl2N5S and a molecular weight of 408.36 g/mol. Its IUPAC name is [5-(3,4-dichlorophenyl)-2-methylsulfanyl-6-pyridin-4-ylpyrimidin-4-yl]hydrazine;ethane.
| Compound Name | [5-(3,4-dichlorophenyl)-2-methylsulfanyl-6-pyridin-4-ylpyrimidin-4-yl]hydrazine;ethane |
|---|---|
| PubChem CID | 142245227 |
| Molecular Formula | C18H19Cl2N5S |
| Molecular Weight | 408.36 g/mol |
| Exact Mass | 407.07 |
| IUPAC Name | [5-(3,4-dichlorophenyl)-2-methylsulfanyl-6-pyridin-4-ylpyrimidin-4-yl]hydrazine;ethane |
| SMILES | CC.CSc1nc(NN)c(-c2ccc(Cl)c(Cl)c2)c(-c2ccncc2)n1 |
| InChI | InChI=1S/C16H13Cl2N5S.C2H6/c1-24-16-21-14(9-4-6-20-7-5-9)13(15(22-16)23-19)10-2-3-11(17)12(18)8-10;1-2/h2-8H,19H2,1H3,(H,21,22,23);1-2H3 |
| InChIKey | BXNOIXOFADCKCH-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 76.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.36 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|