C32H26O8 — CID 142247110
bis(naphthalene-1-carbonyloxymethyl) (1R,5R,6S)-bicyclo[3.1.0]hexane-2,6-dicarboxylate (PubChem CID 142247110) has the molecular formula C32H26O8 and a molecular weight of 538.55 g/mol. Its IUPAC name is bis(naphthalene-1-carbonyloxymethyl) (1R,5R,6S)-bicyclo[3.1.0]hexane-2,6-dicarboxylate.
| Compound Name | bis(naphthalene-1-carbonyloxymethyl) (1R,5R,6S)-bicyclo[3.1.0]hexane-2,6-dicarboxylate |
|---|---|
| PubChem CID | 142247110 |
| Molecular Formula | C32H26O8 |
| Molecular Weight | 538.55 g/mol |
| Exact Mass | 538.16 |
| IUPAC Name | bis(naphthalene-1-carbonyloxymethyl) (1R,5R,6S)-bicyclo[3.1.0]hexane-2,6-dicarboxylate |
| SMILES | O=C(OCOC(=O)C1CC[C@H]2[C@H](C(=O)OCOC(=O)c3cccc4ccccc34)[C@@H]12)c1cccc2ccccc12 |
| InChI | InChI=1S/C32H26O8/c33-29(23-13-5-9-19-7-1-3-11-21(19)23)37-17-39-31(35)26-16-15-25-27(26)28(25)32(36)40-18-38-30(34)24-14-6-10-20-8-2-4-12-22(20)24/h1-14,25-28H,15-18H2/t25-,26?,27-,28+/m1/s1 |
| InChIKey | FRDRRUUCWZEJLO-UBOLQYRXSA-N |
| XLogP | 5.28 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.55 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|