C28H33ClN2O4 — CID 142252239
ethyl 4-[[4-chloro-2-[(3E)-5-ethoxy-5-oxopenta-1,3-dien-2-yl]phenyl]-(3-methyl-2-pyridinyl)methyl]piperidine-1-carboxylate (PubChem CID 142252239) has the molecular formula C28H33ClN2O4 and a molecular weight of 497.04 g/mol. Its IUPAC name is ethyl 4-[[4-chloro-2-[(3E)-5-ethoxy-5-oxopenta-1,3-dien-2-yl]phenyl]-(3-methyl-2-pyridinyl)methyl]piperidine-1-carboxylate.
| Compound Name | ethyl 4-[[4-chloro-2-[(3E)-5-ethoxy-5-oxopenta-1,3-dien-2-yl]phenyl]-(3-methyl-2-pyridinyl)methyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 142252239 |
| Molecular Formula | C28H33ClN2O4 |
| Molecular Weight | 497.04 g/mol |
| Exact Mass | 496.21 |
| IUPAC Name | ethyl 4-[[4-chloro-2-[(3E)-5-ethoxy-5-oxopenta-1,3-dien-2-yl]phenyl]-(3-methyl-2-pyridinyl)methyl]piperidine-1-carboxylate |
| SMILES | C=C(/C=C/C(=O)OCC)c1cc(Cl)ccc1C(c1ncccc1C)C1CCN(C(=O)OCC)CC1 |
| InChI | InChI=1S/C28H33ClN2O4/c1-5-34-25(32)12-9-19(3)24-18-22(29)10-11-23(24)26(27-20(4)8-7-15-30-27)21-13-16-31(17-14-21)28(33)35-6-2/h7-12,15,18,21,26H,3,5-6,13-14,16-17H2,1-2,4H3/b12-9+ |
| InChIKey | VAESTLSOHUDUHK-FMIVXFBMSA-N |
| XLogP | 6.18 |
| TPSA | 68.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.04 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|