C26H18N4O — CID 142252966
15-phenyl-3,21-dihydroporphyrin-2-ol (PubChem CID 142252966) has the molecular formula C26H18N4O and a molecular weight of 402.46 g/mol. Its IUPAC name is 15-phenyl-3,21-dihydroporphyrin-2-ol.
| Compound Name | 15-phenyl-3,21-dihydroporphyrin-2-ol |
|---|---|
| PubChem CID | 142252966 |
| Molecular Formula | C26H18N4O |
| Molecular Weight | 402.46 g/mol |
| Exact Mass | 402.15 |
| IUPAC Name | 15-phenyl-3,21-dihydroporphyrin-2-ol |
| SMILES | OC1=C2/C=C3/C=CC(=N3)/C(c3ccccc3)=C3/C=CC(=N3)/C=C3/C=CC(=N3)/C=C(/C1)N2 |
| InChI | InChI=1S/C26H18N4O/c31-25-15-21-13-18-7-6-17(27-18)12-19-8-10-22(28-19)26(16-4-2-1-3-5-16)23-11-9-20(29-23)14-24(25)30-21/h1-14,30-31H,15H2/b17-12-,20-14-,21-13-,26-22- |
| InChIKey | SLAVJBQPGRPIDJ-JRVPCDTASA-N |
| XLogP | 4.86 |
| TPSA | 69.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.46 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |