C27H18N4O — CID 162517547
(Z)-(3-phenyl-23H-porphyrin-2-ylidene)methanol (PubChem CID 162517547) has the molecular formula C27H18N4O and a molecular weight of 414.47 g/mol. Its IUPAC name is (Z)-(3-phenyl-23H-porphyrin-2-ylidene)methanol.
| Compound Name | (Z)-(3-phenyl-23H-porphyrin-2-ylidene)methanol |
|---|---|
| PubChem CID | 162517547 |
| Molecular Formula | C27H18N4O |
| Molecular Weight | 414.47 g/mol |
| Exact Mass | 414.15 |
| IUPAC Name | (Z)-(3-phenyl-23H-porphyrin-2-ylidene)methanol |
| SMILES | O/C=C1\C2=NC(=C1c1ccccc1)/C=C1/C=CC(=N1)/C=c1/cc/c([nH]1)=C/C1=N/C(=C\2)C=C1 |
| InChI | InChI=1S/C27H18N4O/c32-16-24-25-14-22-10-8-20(29-22)12-18-6-7-19(28-18)13-21-9-11-23(30-21)15-26(31-25)27(24)17-4-2-1-3-5-17/h1-16,28,32H/b18-12-,19-13-,22-14-,23-15-,24-16+ |
| InChIKey | VJLUOGLUWSDLBR-LRGDTMTBSA-N |
| XLogP | 3.69 |
| TPSA | 73.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.47 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|