C14H14N4O3 — CID 142256542
1-[5-(hydroxymethyl)oxolan-2-yl]-7H-imidazo[4,5-g]quinazolin-8-one (PubChem CID 142256542) has the molecular formula C14H14N4O3 and a molecular weight of 286.29 g/mol. Its IUPAC name is 1-[5-(hydroxymethyl)oxolan-2-yl]-7H-imidazo[4,5-g]quinazolin-8-one.
| Compound Name | 1-[5-(hydroxymethyl)oxolan-2-yl]-7H-imidazo[4,5-g]quinazolin-8-one |
|---|---|
| PubChem CID | 142256542 |
| Molecular Formula | C14H14N4O3 |
| Molecular Weight | 286.29 g/mol |
| Exact Mass | 286.11 |
| IUPAC Name | 1-[5-(hydroxymethyl)oxolan-2-yl]-7H-imidazo[4,5-g]quinazolin-8-one |
| SMILES | O=c1[nH]cnc2cc3ncn(C4CCC(CO)O4)c3cc12 |
| InChI | InChI=1S/C14H14N4O3/c19-5-8-1-2-13(21-8)18-7-17-11-4-10-9(3-12(11)18)14(20)16-6-15-10/h3-4,6-8,13,19H,1-2,5H2,(H,15,16,20) |
| InChIKey | YOFFHJAAWSJCFG-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 93.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.29 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |