C16H14ClN3O2S2 — CID 142258434
6-chloro-5-(3-propylindol-1-yl)sulfonylimidazo[2,1-b][1,3]thiazole (PubChem CID 142258434) has the molecular formula C16H14ClN3O2S2 and a molecular weight of 379.89 g/mol. Its IUPAC name is 6-chloro-5-(3-propylindol-1-yl)sulfonylimidazo[2,1-b][1,3]thiazole.
| Compound Name | 6-chloro-5-(3-propylindol-1-yl)sulfonylimidazo[2,1-b][1,3]thiazole |
|---|---|
| PubChem CID | 142258434 |
| Molecular Formula | C16H14ClN3O2S2 |
| Molecular Weight | 379.89 g/mol |
| Exact Mass | 379.02 |
| IUPAC Name | 6-chloro-5-(3-propylindol-1-yl)sulfonylimidazo[2,1-b][1,3]thiazole |
| SMILES | CCCc1cn(S(=O)(=O)c2c(Cl)nc3sccn23)c2ccccc12 |
| InChI | InChI=1S/C16H14ClN3O2S2/c1-2-5-11-10-20(13-7-4-3-6-12(11)13)24(21,22)15-14(17)18-16-19(15)8-9-23-16/h3-4,6-10H,2,5H2,1H3 |
| InChIKey | KQVOMHLCMPGNIR-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 56.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.89 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |