C26H27NO5 — CID 142258837
ethyl (1R)-2-(hydroxycarbamoyl)-1-[[4-hydroxy-3-(1-naphthalen-1-ylethyl)phenyl]methyl]cyclopropane-1-carboxylate (PubChem CID 142258837) has the molecular formula C26H27NO5 and a molecular weight of 433.50 g/mol. Its IUPAC name is ethyl (1R)-2-(hydroxycarbamoyl)-1-[[4-hydroxy-3-(1-naphthalen-1-ylethyl)phenyl]methyl]cyclopropane-1-carboxylate.
| Compound Name | ethyl (1R)-2-(hydroxycarbamoyl)-1-[[4-hydroxy-3-(1-naphthalen-1-ylethyl)phenyl]methyl]cyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 142258837 |
| Molecular Formula | C26H27NO5 |
| Molecular Weight | 433.50 g/mol |
| Exact Mass | 433.19 |
| IUPAC Name | ethyl (1R)-2-(hydroxycarbamoyl)-1-[[4-hydroxy-3-(1-naphthalen-1-ylethyl)phenyl]methyl]cyclopropane-1-carboxylate |
| SMILES | CCOC(=O)[C@@]1(Cc2ccc(O)c(C(C)c3cccc4ccccc34)c2)CC1C(=O)NO |
| InChI | InChI=1S/C26H27NO5/c1-3-32-25(30)26(15-22(26)24(29)27-31)14-17-11-12-23(28)21(13-17)16(2)19-10-6-8-18-7-4-5-9-20(18)19/h4-13,16,22,28,31H,3,14-15H2,1-2H3,(H,27,29)/t16?,22?,26-/m0/s1 |
| InChIKey | DHKCVDFDWSLRML-QXJVASPBSA-N |
| XLogP | 4.31 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.50 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|