C24H23NO5 — CID 20748809
methyl 2-(hydroxycarbamoyl)-1-[[4-hydroxy-3-(naphthalen-1-ylmethyl)phenyl]methyl]cyclopropane-1-carboxylate (PubChem CID 20748809) has the molecular formula C24H23NO5 and a molecular weight of 405.45 g/mol. Its IUPAC name is methyl 2-(hydroxycarbamoyl)-1-[[4-hydroxy-3-(naphthalen-1-ylmethyl)phenyl]methyl]cyclopropane-1-carboxylate.
| Compound Name | methyl 2-(hydroxycarbamoyl)-1-[[4-hydroxy-3-(naphthalen-1-ylmethyl)phenyl]methyl]cyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 20748809 |
| Molecular Formula | C24H23NO5 |
| Molecular Weight | 405.45 g/mol |
| Exact Mass | 405.16 |
| IUPAC Name | methyl 2-(hydroxycarbamoyl)-1-[[4-hydroxy-3-(naphthalen-1-ylmethyl)phenyl]methyl]cyclopropane-1-carboxylate |
| SMILES | COC(=O)C1(Cc2ccc(O)c(Cc3cccc4ccccc34)c2)CC1C(=O)NO |
| InChI | InChI=1S/C24H23NO5/c1-30-23(28)24(14-20(24)22(27)25-29)13-15-9-10-21(26)18(11-15)12-17-7-4-6-16-5-2-3-8-19(16)17/h2-11,20,26,29H,12-14H2,1H3,(H,25,27) |
| InChIKey | FZPRBGARSIVFGC-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.45 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|