C25H25NO5 — CID 59978412
cis-ethyl (1R,2S)-2-(hydroxycarbamoyl)-1-[[4-hydroxy-3-(naphthalen-2-ylmethyl)phenyl]methyl]cyclopropane-1-carboxylate (PubChem CID 59978412) has the molecular formula C25H25NO5 and a molecular weight of 419.48 g/mol. Its IUPAC name is cis-ethyl (1R,2S)-2-(hydroxycarbamoyl)-1-[[4-hydroxy-3-(naphthalen-2-ylmethyl)phenyl]methyl]cyclopropane-1-carboxylate.
| Compound Name | cis-ethyl (1R,2S)-2-(hydroxycarbamoyl)-1-[[4-hydroxy-3-(naphthalen-2-ylmethyl)phenyl]methyl]cyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 59978412 |
| Molecular Formula | C25H25NO5 |
| Molecular Weight | 419.48 g/mol |
| Exact Mass | 419.17 |
| IUPAC Name | cis-ethyl (1R,2S)-2-(hydroxycarbamoyl)-1-[[4-hydroxy-3-(naphthalen-2-ylmethyl)phenyl]methyl]cyclopropane-1-carboxylate |
| SMILES | CCOC(=O)[C@@]1(Cc2ccc(O)c(Cc3ccc4ccccc4c3)c2)C[C@@H]1C(=O)NO |
| InChI | InChI=1S/C25H25NO5/c1-2-31-24(29)25(15-21(25)23(28)26-30)14-17-8-10-22(27)20(13-17)12-16-7-9-18-5-3-4-6-19(18)11-16/h3-11,13,21,27,30H,2,12,14-15H2,1H3,(H,26,28)/t21-,25+/m1/s1 |
| InChIKey | NWUIRGAHCMRWDO-BWKNWUBXSA-N |
| XLogP | 3.75 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.48 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|