C19H25NO4S — CID 142259310
tert-butyl 2-amino-5-formyl-4-methylthiophene-3-carboxylate;methoxymethylbenzene (PubChem CID 142259310) has the molecular formula C19H25NO4S and a molecular weight of 363.48 g/mol. Its IUPAC name is tert-butyl 2-amino-5-formyl-4-methylthiophene-3-carboxylate;methoxymethylbenzene.
| Compound Name | tert-butyl 2-amino-5-formyl-4-methylthiophene-3-carboxylate;methoxymethylbenzene |
|---|---|
| PubChem CID | 142259310 |
| Molecular Formula | C19H25NO4S |
| Molecular Weight | 363.48 g/mol |
| Exact Mass | 363.15 |
| IUPAC Name | tert-butyl 2-amino-5-formyl-4-methylthiophene-3-carboxylate;methoxymethylbenzene |
| SMILES | COCc1ccccc1.Cc1c(C=O)sc(N)c1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C11H15NO3S.C8H10O/c1-6-7(5-13)16-9(12)8(6)10(14)15-11(2,3)4;1-9-7-8-5-3-2-4-6-8/h5H,12H2,1-4H3;2-6H,7H2,1H3 |
| InChIKey | QPGGXXKDDAXRSM-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.48 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Aa(45)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|