C19H18F3NO5 — CID 143506999
2-O-benzyl 4-O-tert-butyl 5-formyl-3-(trifluoromethyl)-1H-pyrrole-2,4-dicarboxylate (PubChem CID 143506999) has the molecular formula C19H18F3NO5 and a molecular weight of 397.35 g/mol. Its IUPAC name is 2-O-benzyl 4-O-tert-butyl 5-formyl-3-(trifluoromethyl)-1H-pyrrole-2,4-dicarboxylate.
| Compound Name | 2-O-benzyl 4-O-tert-butyl 5-formyl-3-(trifluoromethyl)-1H-pyrrole-2,4-dicarboxylate |
|---|---|
| PubChem CID | 143506999 |
| Molecular Formula | C19H18F3NO5 |
| Molecular Weight | 397.35 g/mol |
| Exact Mass | 397.11 |
| IUPAC Name | 2-O-benzyl 4-O-tert-butyl 5-formyl-3-(trifluoromethyl)-1H-pyrrole-2,4-dicarboxylate |
| SMILES | CC(C)(C)OC(=O)c1c(C=O)[nH]c(C(=O)OCc2ccccc2)c1C(F)(F)F |
| InChI | InChI=1S/C19H18F3NO5/c1-18(2,3)28-16(25)13-12(9-24)23-15(14(13)19(20,21)22)17(26)27-10-11-7-5-4-6-8-11/h4-9,23H,10H2,1-3H3 |
| InChIKey | RVTFIJFVMGUKHF-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 85.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.35 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|