C19H19BrN4O2 — CID 142269407
1-[3-(4-bromo-1-methylpyrazol-5-yl)phenyl]-3-[(4-methoxyphenyl)methyl]urea (PubChem CID 142269407) has the molecular formula C19H19BrN4O2 and a molecular weight of 415.29 g/mol. Its IUPAC name is 1-[3-(4-bromo-1-methylpyrazol-5-yl)phenyl]-3-[(4-methoxyphenyl)methyl]urea.
| Compound Name | 1-[3-(4-bromo-1-methylpyrazol-5-yl)phenyl]-3-[(4-methoxyphenyl)methyl]urea |
|---|---|
| PubChem CID | 142269407 |
| Molecular Formula | C19H19BrN4O2 |
| Molecular Weight | 415.29 g/mol |
| Exact Mass | 414.07 |
| IUPAC Name | 1-[3-(4-bromo-1-methylpyrazol-5-yl)phenyl]-3-[(4-methoxyphenyl)methyl]urea |
| SMILES | COc1ccc(CNC(=O)Nc2cccc(-c3c(Br)cnn3C)c2)cc1 |
| InChI | InChI=1S/C19H19BrN4O2/c1-24-18(17(20)12-22-24)14-4-3-5-15(10-14)23-19(25)21-11-13-6-8-16(26-2)9-7-13/h3-10,12H,11H2,1-2H3,(H2,21,23,25) |
| InChIKey | DCRJJGBQAAIKET-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 68.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.29 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |