C19H30N2O2 — CID 142272376
4-amino-N-[(3E,5E)-6-methoxy-3-methylocta-3,5-dienyl]benzamide;ethane (PubChem CID 142272376) has the molecular formula C19H30N2O2 and a molecular weight of 318.46 g/mol. Its IUPAC name is 4-amino-N-[(3E,5E)-6-methoxy-3-methylocta-3,5-dienyl]benzamide;ethane.
| Compound Name | 4-amino-N-[(3E,5E)-6-methoxy-3-methylocta-3,5-dienyl]benzamide;ethane |
|---|---|
| PubChem CID | 142272376 |
| Molecular Formula | C19H30N2O2 |
| Molecular Weight | 318.46 g/mol |
| Exact Mass | 318.23 |
| IUPAC Name | 4-amino-N-[(3E,5E)-6-methoxy-3-methylocta-3,5-dienyl]benzamide;ethane |
| SMILES | CC.CC/C(=C\C=C(/C)CCNC(=O)c1ccc(N)cc1)OC |
| InChI | InChI=1S/C17H24N2O2.C2H6/c1-4-16(21-3)10-5-13(2)11-12-19-17(20)14-6-8-15(18)9-7-14;1-2/h5-10H,4,11-12,18H2,1-3H3,(H,19,20);1-2H3/b13-5+,16-10+; |
| InChIKey | LHKDBJQPOIMSPR-WTCUAGPYSA-N |
| XLogP | 4.30 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.46 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|