C12H21N3O3 — CID 142273744
ethane;2-formamidoacetic acid;(4-methylphenyl)hydrazine (PubChem CID 142273744) has the molecular formula C12H21N3O3 and a molecular weight of 255.32 g/mol. Its IUPAC name is ethane;2-formamidoacetic acid;(4-methylphenyl)hydrazine.
| Compound Name | ethane;2-formamidoacetic acid;(4-methylphenyl)hydrazine |
|---|---|
| PubChem CID | 142273744 |
| Molecular Formula | C12H21N3O3 |
| Molecular Weight | 255.32 g/mol |
| Exact Mass | 255.16 |
| IUPAC Name | ethane;2-formamidoacetic acid;(4-methylphenyl)hydrazine |
| SMILES | CC.Cc1ccc(NN)cc1.O=CNCC(=O)O |
| InChI | InChI=1S/C7H10N2.C3H5NO3.C2H6/c1-6-2-4-7(9-8)5-3-6;5-2-4-1-3(6)7;1-2/h2-5,9H,8H2,1H3;2H,1H2,(H,4,5)(H,6,7);1-2H3 |
| InChIKey | ALHPYRQVZSFGDU-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 104.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.32 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|