C16H18O3 — CID 142273800
[(3E)-3-[(2-methylphenyl)methyl]-2-oxohexa-3,5-dienyl] acetate (PubChem CID 142273800) has the molecular formula C16H18O3 and a molecular weight of 258.32 g/mol. Its IUPAC name is [(3E)-3-[(2-methylphenyl)methyl]-2-oxohexa-3,5-dienyl] acetate.
| Compound Name | [(3E)-3-[(2-methylphenyl)methyl]-2-oxohexa-3,5-dienyl] acetate |
|---|---|
| PubChem CID | 142273800 |
| Molecular Formula | C16H18O3 |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.13 |
| IUPAC Name | [(3E)-3-[(2-methylphenyl)methyl]-2-oxohexa-3,5-dienyl] acetate |
| SMILES | C=C/C=C(\Cc1ccccc1C)C(=O)COC(C)=O |
| InChI | InChI=1S/C16H18O3/c1-4-7-15(16(18)11-19-13(3)17)10-14-9-6-5-8-12(14)2/h4-9H,1,10-11H2,2-3H3/b15-7+ |
| InChIKey | AZDORLGDYKWIBY-VIZOYTHASA-N |
| XLogP | 2.78 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|