C12F16 — CID 14227408
1,2,2,4,5,6,7-heptafluoro-1,3,3-tris(trifluoromethyl)indene (PubChem CID 14227408) has the molecular formula C12F16 and a molecular weight of 448.10 g/mol. Its IUPAC name is 1,2,2,4,5,6,7-heptafluoro-1,3,3-tris(trifluoromethyl)indene.
| Compound Name | 1,2,2,4,5,6,7-heptafluoro-1,3,3-tris(trifluoromethyl)indene |
|---|---|
| PubChem CID | 14227408 |
| Molecular Formula | C12F16 |
| Molecular Weight | 448.10 g/mol |
| Exact Mass | 447.97 |
| IUPAC Name | 1,2,2,4,5,6,7-heptafluoro-1,3,3-tris(trifluoromethyl)indene |
| SMILES | Fc1c(F)c(F)c2c(c1F)C(F)(C(F)(F)F)C(F)(F)C2(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C12F16/c13-3-1-2(4(14)6(16)5(3)15)8(17,12(26,27)28)9(18,19)7(1,10(20,21)22)11(23,24)25 |
| InChIKey | BBQZOKZCTAFSPA-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.10 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|