C11H18O2 — CID 142276356
(4E,5E)-4,5-di(ethylidene)oxan-3-one;ethane (PubChem CID 142276356) has the molecular formula C11H18O2 and a molecular weight of 182.26 g/mol. Its IUPAC name is (4E,5E)-4,5-di(ethylidene)oxan-3-one;ethane.
| Compound Name | (4E,5E)-4,5-di(ethylidene)oxan-3-one;ethane |
|---|---|
| PubChem CID | 142276356 |
| Molecular Formula | C11H18O2 |
| Molecular Weight | 182.26 g/mol |
| Exact Mass | 182.13 |
| IUPAC Name | (4E,5E)-4,5-di(ethylidene)oxan-3-one;ethane |
| SMILES | C/C=C1/COCC(=O)/C1=C/C.CC |
| InChI | InChI=1S/C9H12O2.C2H6/c1-3-7-5-11-6-9(10)8(7)4-2;1-2/h3-4H,5-6H2,1-2H3;1-2H3/b7-3-,8-4+; |
| InChIKey | QNFZYRCFUSFFIY-ONANWKRQSA-N |
| XLogP | 2.50 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.26 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|