C27H44FN — CID 142281429
(7E,11Z)-8-fluoro-N,5,14,17-tetramethyl-6,9,10,13-tetramethylidenenonadeca-7,11-dien-2-amine (PubChem CID 142281429) has the molecular formula C27H44FN and a molecular weight of 401.65 g/mol. Its IUPAC name is (7E,11Z)-8-fluoro-N,5,14,17-tetramethyl-6,9,10,13-tetramethylidenenonadeca-7,11-dien-2-amine.
| Compound Name | (7E,11Z)-8-fluoro-N,5,14,17-tetramethyl-6,9,10,13-tetramethylidenenonadeca-7,11-dien-2-amine |
|---|---|
| PubChem CID | 142281429 |
| Molecular Formula | C27H44FN |
| Molecular Weight | 401.65 g/mol |
| Exact Mass | 401.35 |
| IUPAC Name | (7E,11Z)-8-fluoro-N,5,14,17-tetramethyl-6,9,10,13-tetramethylidenenonadeca-7,11-dien-2-amine |
| SMILES | C=C(/C=C\C(=C)C(C)CCC(C)CC)C(=C)/C(F)=C\C(=C)C(C)CCC(C)NC |
| InChI | InChI=1S/C27H44FN/c1-11-19(2)12-13-20(3)21(4)14-15-23(6)26(9)27(28)18-24(7)22(5)16-17-25(8)29-10/h14-15,18-20,22,25,29H,4,6-7,9,11-13,16-17H2,1-3,5,8,10H3/b15-14-,27-18+ |
| InChIKey | OTZQNPQKWXTJMU-NSMAEENOSA-N |
| XLogP | 8.11 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.65 |
| LogP ≤ 5 | 8.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|