C32H48F2O — CID 142282758
1-[(E)-1,2-difluoro-2-[4-(4-pentylcyclohexyl)cyclohexyl]ethenyl]-4-(1-methoxy-4-methylpent-4-en-2-yl)benzene (PubChem CID 142282758) has the molecular formula C32H48F2O and a molecular weight of 486.73 g/mol. Its IUPAC name is 1-[(E)-1,2-difluoro-2-[4-(4-pentylcyclohexyl)cyclohexyl]ethenyl]-4-(1-methoxy-4-methylpent-4-en-2-yl)benzene.
| Compound Name | 1-[(E)-1,2-difluoro-2-[4-(4-pentylcyclohexyl)cyclohexyl]ethenyl]-4-(1-methoxy-4-methylpent-4-en-2-yl)benzene |
|---|---|
| PubChem CID | 142282758 |
| Molecular Formula | C32H48F2O |
| Molecular Weight | 486.73 g/mol |
| Exact Mass | 486.37 |
| IUPAC Name | 1-[(E)-1,2-difluoro-2-[4-(4-pentylcyclohexyl)cyclohexyl]ethenyl]-4-(1-methoxy-4-methylpent-4-en-2-yl)benzene |
| SMILES | C=C(C)CC(COC)c1ccc(/C(F)=C(\F)C2CCC(C3CCC(CCCCC)CC3)CC2)cc1 |
| InChI | InChI=1S/C32H48F2O/c1-5-6-7-8-24-9-11-25(12-10-24)26-13-17-28(18-14-26)31(33)32(34)29-19-15-27(16-20-29)30(22-35-4)21-23(2)3/h15-16,19-20,24-26,28,30H,2,5-14,17-18,21-22H2,1,3-4H3/b32-31+ |
| InChIKey | BXAJBPBDTNKTGZ-QNEJGDQOSA-N |
| XLogP | 10.18 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.73 |
| LogP ≤ 5 | 10.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|