C21H32O — CID 142282907
(3Z,7Z)-2-methoxy-10,13-dimethyl-5,6,9-trimethylidenepentadeca-1,3,7-triene (PubChem CID 142282907) has the molecular formula C21H32O and a molecular weight of 300.49 g/mol. Its IUPAC name is (3Z,7Z)-2-methoxy-10,13-dimethyl-5,6,9-trimethylidenepentadeca-1,3,7-triene.
| Compound Name | (3Z,7Z)-2-methoxy-10,13-dimethyl-5,6,9-trimethylidenepentadeca-1,3,7-triene |
|---|---|
| PubChem CID | 142282907 |
| Molecular Formula | C21H32O |
| Molecular Weight | 300.49 g/mol |
| Exact Mass | 300.25 |
| IUPAC Name | (3Z,7Z)-2-methoxy-10,13-dimethyl-5,6,9-trimethylidenepentadeca-1,3,7-triene |
| SMILES | C=C(/C=C\C(=C)C(=C)/C=C\C(=C)C(C)CCC(C)CC)OC |
| InChI | InChI=1S/C21H32O/c1-9-16(2)10-11-17(3)18(4)12-13-19(5)20(6)14-15-21(7)22-8/h12-17H,4-7,9-11H2,1-3,8H3/b13-12-,15-14- |
| InChIKey | VVDDDGAFKWTPBJ-ZJQKOVPWSA-N |
| XLogP | 6.39 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.49 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|