C30H42O8 — CID 142284295
1-O-benzyl 4-O-[(2E)-2-ethenylpenta-2,4-dienyl] butanedioate;butanoic acid;2,2,4-trimethylpent-4-enoic acid (PubChem CID 142284295) has the molecular formula C30H42O8 and a molecular weight of 530.66 g/mol. Its IUPAC name is 1-O-benzyl 4-O-[(2E)-2-ethenylpenta-2,4-dienyl] butanedioate;butanoic acid;2,2,4-trimethylpent-4-enoic acid.
| Compound Name | 1-O-benzyl 4-O-[(2E)-2-ethenylpenta-2,4-dienyl] butanedioate;butanoic acid;2,2,4-trimethylpent-4-enoic acid |
|---|---|
| PubChem CID | 142284295 |
| Molecular Formula | C30H42O8 |
| Molecular Weight | 530.66 g/mol |
| Exact Mass | 530.29 |
| IUPAC Name | 1-O-benzyl 4-O-[(2E)-2-ethenylpenta-2,4-dienyl] butanedioate;butanoic acid;2,2,4-trimethylpent-4-enoic acid |
| SMILES | C=C(C)CC(C)(C)C(=O)O.C=C/C=C(\C=C)COC(=O)CCC(=O)OCc1ccccc1.CCCC(=O)O |
| InChI | InChI=1S/C18H20O4.C8H14O2.C4H8O2/c1-3-8-15(4-2)13-21-17(19)11-12-18(20)22-14-16-9-6-5-7-10-16;1-6(2)5-8(3,4)7(9)10;1-2-3-4(5)6/h3-10H,1-2,11-14H2;1,5H2,2-4H3,(H,9,10);2-3H2,1H3,(H,5,6)/b15-8+;; |
| InChIKey | BOAAPRUMZMQNRP-OLIKVXRNSA-N |
| XLogP | 6.29 |
| TPSA | 127.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.66 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|