C15H20 — CID 142289547
(3E,5E)-6,7-bis(ethenyl)-3-methyldeca-1,3,5,9-tetraene (PubChem CID 142289547) has the molecular formula C15H20 and a molecular weight of 200.32 g/mol. Its IUPAC name is (3E,5E)-6,7-bis(ethenyl)-3-methyldeca-1,3,5,9-tetraene.
| Compound Name | (3E,5E)-6,7-bis(ethenyl)-3-methyldeca-1,3,5,9-tetraene |
|---|---|
| PubChem CID | 142289547 |
| Molecular Formula | C15H20 |
| Molecular Weight | 200.32 g/mol |
| Exact Mass | 200.16 |
| IUPAC Name | (3E,5E)-6,7-bis(ethenyl)-3-methyldeca-1,3,5,9-tetraene |
| SMILES | C=CCC(C=C)/C(C=C)=C/C=C(\C)C=C |
| InChI | InChI=1S/C15H20/c1-6-10-14(8-3)15(9-4)12-11-13(5)7-2/h6-9,11-12,14H,1-4,10H2,5H3/b13-11+,15-12+ |
| InChIKey | SWOUAVVIZUPXBV-CEHLPYKYSA-N |
| XLogP | 4.61 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.32 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|