C19H13BrN2O3 — CID 142297635
5-(aminomethyl)-2-(4-bromo-3-hydroxyquinolin-2-yl)indene-1,3-dione (PubChem CID 142297635) has the molecular formula C19H13BrN2O3 and a molecular weight of 397.23 g/mol. Its IUPAC name is 5-(aminomethyl)-2-(4-bromo-3-hydroxyquinolin-2-yl)indene-1,3-dione.
| Compound Name | 5-(aminomethyl)-2-(4-bromo-3-hydroxyquinolin-2-yl)indene-1,3-dione |
|---|---|
| PubChem CID | 142297635 |
| Molecular Formula | C19H13BrN2O3 |
| Molecular Weight | 397.23 g/mol |
| Exact Mass | 396.01 |
| IUPAC Name | 5-(aminomethyl)-2-(4-bromo-3-hydroxyquinolin-2-yl)indene-1,3-dione |
| SMILES | NCc1ccc2c(c1)C(=O)C(c1nc3ccccc3c(Br)c1O)C2=O |
| InChI | InChI=1S/C19H13BrN2O3/c20-15-11-3-1-2-4-13(11)22-16(19(15)25)14-17(23)10-6-5-9(8-21)7-12(10)18(14)24/h1-7,14,25H,8,21H2 |
| InChIKey | LZYCXHUKVRTZSN-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 93.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.23 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|