C26H17NO5 — CID 123749929
5-[(E)-2-(3,4-dihydroxyphenyl)ethenyl]-2-(3-hydroxyquinolin-2-yl)indene-1,3-dione (PubChem CID 123749929) has the molecular formula C26H17NO5 and a molecular weight of 423.42 g/mol. Its IUPAC name is 5-[(E)-2-(3,4-dihydroxyphenyl)ethenyl]-2-(3-hydroxyquinolin-2-yl)indene-1,3-dione.
| Compound Name | 5-[(E)-2-(3,4-dihydroxyphenyl)ethenyl]-2-(3-hydroxyquinolin-2-yl)indene-1,3-dione |
|---|---|
| PubChem CID | 123749929 |
| Molecular Formula | C26H17NO5 |
| Molecular Weight | 423.42 g/mol |
| Exact Mass | 423.11 |
| IUPAC Name | 5-[(E)-2-(3,4-dihydroxyphenyl)ethenyl]-2-(3-hydroxyquinolin-2-yl)indene-1,3-dione |
| SMILES | O=C1c2ccc(/C=C/c3ccc(O)c(O)c3)cc2C(=O)C1c1nc2ccccc2cc1O |
| InChI | InChI=1S/C26H17NO5/c28-20-10-8-15(12-21(20)29)6-5-14-7-9-17-18(11-14)26(32)23(25(17)31)24-22(30)13-16-3-1-2-4-19(16)27-24/h1-13,23,28-30H/b6-5+ |
| InChIKey | MZNSRFOMWYMDRN-AATRIKPKSA-N |
| XLogP | 4.68 |
| TPSA | 107.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.42 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|