C17H14 — CID 142298089
8-methyl-1,2-dihydrofluoranthene (PubChem CID 142298089) has the molecular formula C17H14 and a molecular weight of 218.30 g/mol. Its IUPAC name is 8-methyl-1,2-dihydrofluoranthene.
| Compound Name | 8-methyl-1,2-dihydrofluoranthene |
|---|---|
| PubChem CID | 142298089 |
| Molecular Formula | C17H14 |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.11 |
| IUPAC Name | 8-methyl-1,2-dihydrofluoranthene |
| SMILES | Cc1ccc2c(c1)-c1cccc3c1=C2CCC=3 |
| InChI | InChI=1S/C17H14/c1-11-8-9-13-14-6-2-4-12-5-3-7-15(17(12)14)16(13)10-11/h3-5,7-10H,2,6H2,1H3 |
| InChIKey | HIEIBKBUBDEBBS-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |