C14H28N6O2 — CID 142298326
2-[3-(aminomethylideneamino)propyl]-8-(diaminomethylideneamino)-N-methyl-4-oxooctanamide (PubChem CID 142298326) has the molecular formula C14H28N6O2 and a molecular weight of 312.42 g/mol. Its IUPAC name is 2-[3-(aminomethylideneamino)propyl]-8-(diaminomethylideneamino)-N-methyl-4-oxooctanamide.
| Compound Name | 2-[3-(aminomethylideneamino)propyl]-8-(diaminomethylideneamino)-N-methyl-4-oxooctanamide |
|---|---|
| PubChem CID | 142298326 |
| Molecular Formula | C14H28N6O2 |
| Molecular Weight | 312.42 g/mol |
| Exact Mass | 312.23 |
| IUPAC Name | 2-[3-(aminomethylideneamino)propyl]-8-(diaminomethylideneamino)-N-methyl-4-oxooctanamide |
| SMILES | CNC(=O)C(CCC/N=C/N)CC(=O)CCCCN=C(N)N |
| InChI | InChI=1S/C14H28N6O2/c1-18-13(22)11(5-4-7-19-10-15)9-12(21)6-2-3-8-20-14(16)17/h10-11H,2-9H2,1H3,(H2,15,19)(H,18,22)(H4,16,17,20) |
| InChIKey | CFTVXWYQJFRPAW-UHFFFAOYSA-N |
| XLogP | -0.48 |
| TPSA | 148.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.42 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|