About N'-(4-hydroxyphenyl)benzenecarboximidamide;pentane;1H-pyrrole
N'-(4-hydroxyphenyl)benzenecarboximidamide;pentane;1H-pyrrole (PubChem CID 142299251) has the molecular formula C22H29N3O
and a molecular weight of 351.49 g/mol. Its IUPAC name is N'-(4-hydroxyphenyl)benzenecarboximidamide;pentane;1H-pyrrole.
Molecular Properties
| Compound Name | N'-(4-hydroxyphenyl)benzenecarboximidamide;pentane;1H-pyrrole |
| PubChem CID | 142299251 |
| Molecular Formula | C22H29N3O |
| Molecular Weight | 351.49 g/mol |
| Exact Mass | 351.23 |
| IUPAC Name | N'-(4-hydroxyphenyl)benzenecarboximidamide;pentane;1H-pyrrole |
| SMILES | CCCCC.N/C(=N\c1ccc(O)cc1)c1ccccc1.c1cc[nH]c1 |
| InChI | InChI=1S/C13H12N2O.C5H12.C4H5N/c14-13(10-4-2-1-3-5-10)15-11-6-8-12(16)9-7-11;1-3-5-4-2;1-2-4-5-3-1/h1-9,16H,(H2,14,15);3-5H2,1-2H3;1-5H |
| InChIKey | DHGKZJVSXYUCMY-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 74.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 351.49 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N'-(4-hydroxyphenyl)benzenecarboximidamide;pentane;1H-pyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(4-hydroxyphenyl)benzenecarboximidamide;pentane;1H-pyrrole?
The IUPAC name of N'-(4-hydroxyphenyl)benzenecarboximidamide;pentane;1H-pyrrole (CID 142299251) is N'-(4-hydroxyphenyl)benzenecarboximidamide;pentane;1H-pyrrole.
What is the SMILES notation for N'-(4-hydroxyphenyl)benzenecarboximidamide;pentane;1H-pyrrole?
The canonical SMILES for N'-(4-hydroxyphenyl)benzenecarboximidamide;pentane;1H-pyrrole is CCCCC.N/C(=N\c1ccc(O)cc1)c1ccccc1.c1cc[nH]c1.
What is the InChIKey of N'-(4-hydroxyphenyl)benzenecarboximidamide;pentane;1H-pyrrole?
The InChIKey is DHGKZJVSXYUCMY-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12N2O.C5H12.C4H5N/c14-13(10-4-2-1-3-5-10)15-11-6-8-12(16)9-7-11;1-3-5-4-2;1-2-4-5-3-1/h1-9,16H,(H2,14,15);3-5H2,1-2H3;1-5H.
What are the key properties of N'-(4-hydroxyphenyl)benzenecarboximidamide;pentane;1H-pyrrole?
N'-(4-hydroxyphenyl)benzenecarboximidamide;pentane;1H-pyrrole has a molecular weight of 351.49 g/mol, XLogP of 5.64, 4 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(4-hydroxyphenyl)benzenecarboximidamide;pentane;1H-pyrrole is sourced from PubChem (CID 142299251), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).