C20H27N5O — CID 142299218
N'-(4-hydroxyphenyl)pyridine-2-carboximidamide;1H-imidazole;pentane (PubChem CID 142299218) has the molecular formula C20H27N5O and a molecular weight of 353.47 g/mol. Its IUPAC name is N'-(4-hydroxyphenyl)pyridine-2-carboximidamide;1H-imidazole;pentane.
| Compound Name | N'-(4-hydroxyphenyl)pyridine-2-carboximidamide;1H-imidazole;pentane |
|---|---|
| PubChem CID | 142299218 |
| Molecular Formula | C20H27N5O |
| Molecular Weight | 353.47 g/mol |
| Exact Mass | 353.22 |
| IUPAC Name | N'-(4-hydroxyphenyl)pyridine-2-carboximidamide;1H-imidazole;pentane |
| SMILES | CCCCC.N/C(=N\c1ccc(O)cc1)c1ccccn1.c1c[nH]cn1 |
| InChI | InChI=1S/C12H11N3O.C5H12.C3H4N2/c13-12(11-3-1-2-8-14-11)15-9-4-6-10(16)7-5-9;1-3-5-4-2;1-2-5-3-4-1/h1-8,16H,(H2,13,15);3-5H2,1-2H3;1-3H,(H,4,5) |
| InChIKey | JQPISPVRXBMEEI-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 100.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.47 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|