C21H42N2O2 — CID 142299348
tert-butyl formate;2-N,2-dimethyl-1-N-[(E)-2-[(Z)-prop-1-enyl]pent-2-enyl]hexane-1,2-diamine (PubChem CID 142299348) has the molecular formula C21H42N2O2 and a molecular weight of 354.58 g/mol. Its IUPAC name is tert-butyl formate;2-N,2-dimethyl-1-N-[(E)-2-[(Z)-prop-1-enyl]pent-2-enyl]hexane-1,2-diamine.
| Compound Name | tert-butyl formate;2-N,2-dimethyl-1-N-[(E)-2-[(Z)-prop-1-enyl]pent-2-enyl]hexane-1,2-diamine |
|---|---|
| PubChem CID | 142299348 |
| Molecular Formula | C21H42N2O2 |
| Molecular Weight | 354.58 g/mol |
| Exact Mass | 354.32 |
| IUPAC Name | tert-butyl formate;2-N,2-dimethyl-1-N-[(E)-2-[(Z)-prop-1-enyl]pent-2-enyl]hexane-1,2-diamine |
| SMILES | C/C=C\C(=C/CC)CNCC(C)(CCCC)NC.CC(C)(C)OC=O |
| InChI | InChI=1S/C16H32N2.C5H10O2/c1-6-9-12-16(4,17-5)14-18-13-15(10-7-2)11-8-3;1-5(2,3)7-4-6/h7,10-11,17-18H,6,8-9,12-14H2,1-5H3;4H,1-3H3/b10-7-,15-11+; |
| InChIKey | OQVZPAQBPYGJHN-HCIYJSQZSA-N |
| XLogP | 4.61 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.58 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|