C16H26FNO4 — CID 144693368
tert-butyl formate;ethyl (3Z)-3-(1-fluoroethenyl)-2-(methylamino)hexa-3,5-dienoate (PubChem CID 144693368) has the molecular formula C16H26FNO4 and a molecular weight of 315.39 g/mol. Its IUPAC name is tert-butyl formate;ethyl (3Z)-3-(1-fluoroethenyl)-2-(methylamino)hexa-3,5-dienoate.
| Compound Name | tert-butyl formate;ethyl (3Z)-3-(1-fluoroethenyl)-2-(methylamino)hexa-3,5-dienoate |
|---|---|
| PubChem CID | 144693368 |
| Molecular Formula | C16H26FNO4 |
| Molecular Weight | 315.39 g/mol |
| Exact Mass | 315.18 |
| IUPAC Name | tert-butyl formate;ethyl (3Z)-3-(1-fluoroethenyl)-2-(methylamino)hexa-3,5-dienoate |
| SMILES | C=C/C=C(\C(=C)F)C(NC)C(=O)OCC.CC(C)(C)OC=O |
| InChI | InChI=1S/C11H16FNO2.C5H10O2/c1-5-7-9(8(3)12)10(13-4)11(14)15-6-2;1-5(2,3)7-4-6/h5,7,10,13H,1,3,6H2,2,4H3;4H,1-3H3/b9-7+; |
| InChIKey | ZGQMERXTYCKKBK-BXTVWIJMSA-N |
| XLogP | 2.69 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.39 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|