C15H33NOS — CID 142299949
ethane;O-propan-2-yl N-(2,5,5-trimethylhexan-2-yl)carbamothioate (PubChem CID 142299949) has the molecular formula C15H33NOS and a molecular weight of 275.50 g/mol. Its IUPAC name is ethane;O-propan-2-yl N-(2,5,5-trimethylhexan-2-yl)carbamothioate.
| Compound Name | ethane;O-propan-2-yl N-(2,5,5-trimethylhexan-2-yl)carbamothioate |
|---|---|
| PubChem CID | 142299949 |
| Molecular Formula | C15H33NOS |
| Molecular Weight | 275.50 g/mol |
| Exact Mass | 275.23 |
| IUPAC Name | ethane;O-propan-2-yl N-(2,5,5-trimethylhexan-2-yl)carbamothioate |
| SMILES | CC.CC(C)OC(=S)NC(C)(C)CCC(C)(C)C |
| InChI | InChI=1S/C13H27NOS.C2H6/c1-10(2)15-11(16)14-13(6,7)9-8-12(3,4)5;1-2/h10H,8-9H2,1-7H3,(H,14,16);1-2H3 |
| InChIKey | KEJOXVZSUFAUBS-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.50 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|