C23H49NOS — CID 142299967
ethane;S-(2,5,5-trimethylhexan-2-yl) N-(2,5,5,6-tetramethylheptan-2-yl)carbamothioate (PubChem CID 142299967) has the molecular formula C23H49NOS and a molecular weight of 387.72 g/mol. Its IUPAC name is ethane;S-(2,5,5-trimethylhexan-2-yl) N-(2,5,5,6-tetramethylheptan-2-yl)carbamothioate.
| Compound Name | ethane;S-(2,5,5-trimethylhexan-2-yl) N-(2,5,5,6-tetramethylheptan-2-yl)carbamothioate |
|---|---|
| PubChem CID | 142299967 |
| Molecular Formula | C23H49NOS |
| Molecular Weight | 387.72 g/mol |
| Exact Mass | 387.35 |
| IUPAC Name | ethane;S-(2,5,5-trimethylhexan-2-yl) N-(2,5,5,6-tetramethylheptan-2-yl)carbamothioate |
| SMILES | CC.CC(C)C(C)(C)CCC(C)(C)NC(=O)SC(C)(C)CCC(C)(C)C |
| InChI | InChI=1S/C21H43NOS.C2H6/c1-16(2)19(6,7)13-14-20(8,9)22-17(23)24-21(10,11)15-12-18(3,4)5;1-2/h16H,12-15H2,1-11H3,(H,22,23);1-2H3 |
| InChIKey | XZQBXLOKYHFWKO-UHFFFAOYSA-N |
| XLogP | 8.30 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.72 |
| LogP ≤ 5 | 8.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|