C18H36N2O2S2 — CID 146602956
O-[5-(tert-butylsulfanylcarbonylamino)-2,5-dimethylhexan-2-yl] N-tert-butylcarbamothioate (PubChem CID 146602956) has the molecular formula C18H36N2O2S2 and a molecular weight of 376.63 g/mol. Its IUPAC name is O-[5-(tert-butylsulfanylcarbonylamino)-2,5-dimethylhexan-2-yl] N-tert-butylcarbamothioate.
| Compound Name | O-[5-(tert-butylsulfanylcarbonylamino)-2,5-dimethylhexan-2-yl] N-tert-butylcarbamothioate |
|---|---|
| PubChem CID | 146602956 |
| Molecular Formula | C18H36N2O2S2 |
| Molecular Weight | 376.63 g/mol |
| Exact Mass | 376.22 |
| IUPAC Name | O-[5-(tert-butylsulfanylcarbonylamino)-2,5-dimethylhexan-2-yl] N-tert-butylcarbamothioate |
| SMILES | CC(C)(C)NC(=S)OC(C)(C)CCC(C)(C)NC(=O)SC(C)(C)C |
| InChI | InChI=1S/C18H36N2O2S2/c1-15(2,3)20-14(23)22-18(9,10)12-11-17(7,8)19-13(21)24-16(4,5)6/h11-12H2,1-10H3,(H,19,21)(H,20,23) |
| InChIKey | WKPVCGIQZLQCHX-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.63 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|