C31H27NO — CID 142301780
N-[4-[2-ethenoxy-3-[(3Z)-penta-1,3-dien-2-yl]phenyl]phenyl]-4-phenylaniline (PubChem CID 142301780) has the molecular formula C31H27NO and a molecular weight of 429.56 g/mol. Its IUPAC name is N-[4-[2-ethenoxy-3-[(3Z)-penta-1,3-dien-2-yl]phenyl]phenyl]-4-phenylaniline.
| Compound Name | N-[4-[2-ethenoxy-3-[(3Z)-penta-1,3-dien-2-yl]phenyl]phenyl]-4-phenylaniline |
|---|---|
| PubChem CID | 142301780 |
| Molecular Formula | C31H27NO |
| Molecular Weight | 429.56 g/mol |
| Exact Mass | 429.21 |
| IUPAC Name | N-[4-[2-ethenoxy-3-[(3Z)-penta-1,3-dien-2-yl]phenyl]phenyl]-4-phenylaniline |
| SMILES | C=COc1c(C(=C)/C=C\C)cccc1-c1ccc(Nc2ccc(-c3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C31H27NO/c1-4-10-23(3)29-13-9-14-30(31(29)33-5-2)26-17-21-28(22-18-26)32-27-19-15-25(16-20-27)24-11-7-6-8-12-24/h4-22,32H,2-3H2,1H3/b10-4- |
| InChIKey | NGWGWOSUGXNPFR-WMZJFQQLSA-N |
| XLogP | 8.88 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.56 |
| LogP ≤ 5 | 8.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|