C21H26N6O3 — CID 142305953
3-[7-[4-[amino-[(Z)-2-aminobut-1-en-3-ynyl]amino]butylamino]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 142305953) has the molecular formula C21H26N6O3 and a molecular weight of 410.48 g/mol. Its IUPAC name is 3-[7-[4-[amino-[(Z)-2-aminobut-1-en-3-ynyl]amino]butylamino]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[7-[4-[amino-[(Z)-2-aminobut-1-en-3-ynyl]amino]butylamino]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 142305953 |
| Molecular Formula | C21H26N6O3 |
| Molecular Weight | 410.48 g/mol |
| Exact Mass | 410.21 |
| IUPAC Name | 3-[7-[4-[amino-[(Z)-2-aminobut-1-en-3-ynyl]amino]butylamino]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | C#C/C(N)=C/N(N)CCCCNc1cccc2c1CN(C1CCC(=O)NC1=O)C2=O |
| InChI | InChI=1S/C21H26N6O3/c1-2-14(22)12-26(23)11-4-3-10-24-17-7-5-6-15-16(17)13-27(21(15)30)18-8-9-19(28)25-20(18)29/h1,5-7,12,18,24H,3-4,8-11,13,22-23H2,(H,25,28,29)/b14-12- |
| InChIKey | IWSAIISCMUBWDY-OWBHPGMISA-N |
| XLogP | 0.25 |
| TPSA | 133.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.48 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|