C11H20N4O2 — CID 142311236
tert-butyl (3R)-4-methyl-3-(2H-tetrazol-5-yl)pentanoate (PubChem CID 142311236) has the molecular formula C11H20N4O2 and a molecular weight of 240.31 g/mol. Its IUPAC name is tert-butyl (3R)-4-methyl-3-(2H-tetrazol-5-yl)pentanoate.
| Compound Name | tert-butyl (3R)-4-methyl-3-(2H-tetrazol-5-yl)pentanoate |
|---|---|
| PubChem CID | 142311236 |
| Molecular Formula | C11H20N4O2 |
| Molecular Weight | 240.31 g/mol |
| Exact Mass | 240.16 |
| IUPAC Name | tert-butyl (3R)-4-methyl-3-(2H-tetrazol-5-yl)pentanoate |
| SMILES | CC(C)[C@@H](CC(=O)OC(C)(C)C)c1nn[nH]n1 |
| InChI | InChI=1S/C11H20N4O2/c1-7(2)8(10-12-14-15-13-10)6-9(16)17-11(3,4)5/h7-8H,6H2,1-5H3,(H,12,13,14,15)/t8-/m1/s1 |
| InChIKey | IRSZLAAXBAAKIY-MRVPVSSYSA-N |
| XLogP | 1.67 |
| TPSA | 80.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.31 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |