C26H44N2O4 — CID 142313716
(E)-but-2-ene;3-[(3Z,5Z)-3-ethenyl-5-[2-(1-oxa-4,9-diazaspiro[5.5]undecan-9-yl)ethyl]hepta-3,5-dienoxy]propanoic acid (PubChem CID 142313716) has the molecular formula C26H44N2O4 and a molecular weight of 448.65 g/mol. Its IUPAC name is (E)-but-2-ene;3-[(3Z,5Z)-3-ethenyl-5-[2-(1-oxa-4,9-diazaspiro[5.5]undecan-9-yl)ethyl]hepta-3,5-dienoxy]propanoic acid.
| Compound Name | (E)-but-2-ene;3-[(3Z,5Z)-3-ethenyl-5-[2-(1-oxa-4,9-diazaspiro[5.5]undecan-9-yl)ethyl]hepta-3,5-dienoxy]propanoic acid |
|---|---|
| PubChem CID | 142313716 |
| Molecular Formula | C26H44N2O4 |
| Molecular Weight | 448.65 g/mol |
| Exact Mass | 448.33 |
| IUPAC Name | (E)-but-2-ene;3-[(3Z,5Z)-3-ethenyl-5-[2-(1-oxa-4,9-diazaspiro[5.5]undecan-9-yl)ethyl]hepta-3,5-dienoxy]propanoic acid |
| SMILES | C/C=C/C.C=C/C(=C\C(=C/C)CCN1CCC2(CC1)CNCCO2)CCOCCC(=O)O |
| InChI | InChI=1S/C22H36N2O4.C4H8/c1-3-19(17-20(4-2)6-14-27-15-7-21(25)26)5-11-24-12-8-22(9-13-24)18-23-10-16-28-22;1-3-4-2/h3-4,17,23H,2,5-16,18H2,1H3,(H,25,26);3-4H,1-2H3/b19-3-,20-17+;4-3+ |
| InChIKey | CCCNCLLDXSRLOH-DVKBLQLPSA-N |
| XLogP | 4.35 |
| TPSA | 71.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.65 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|