C6H8N2O2 — CID 142314329
(5R)-6-hydroxy-1,6-diazabicyclo[3.2.1]oct-3-en-7-one (PubChem CID 142314329) has the molecular formula C6H8N2O2 and a molecular weight of 140.14 g/mol. Its IUPAC name is (5R)-6-hydroxy-1,6-diazabicyclo[3.2.1]oct-3-en-7-one.
| Compound Name | (5R)-6-hydroxy-1,6-diazabicyclo[3.2.1]oct-3-en-7-one |
|---|---|
| PubChem CID | 142314329 |
| Molecular Formula | C6H8N2O2 |
| Molecular Weight | 140.14 g/mol |
| Exact Mass | 140.06 |
| IUPAC Name | (5R)-6-hydroxy-1,6-diazabicyclo[3.2.1]oct-3-en-7-one |
| SMILES | O=C1N2CC=C[C@H](C2)N1O |
| InChI | InChI=1S/C6H8N2O2/c9-6-7-3-1-2-5(4-7)8(6)10/h1-2,5,10H,3-4H2/t5-/m1/s1 |
| InChIKey | MFXSIGKELMVAAS-RXMQYKEDSA-N |
| XLogP | 0.05 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 140.14 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|