C30H26F3N7O3S2 — CID 142320674
3-(2-acetyl-5-methylphenyl)-2-methylimino-1,3-thiazolidin-4-one;N-[(E)-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]methylideneamino]methanethioamide (PubChem CID 142320674) has the molecular formula C30H26F3N7O3S2 and a molecular weight of 653.71 g/mol. Its IUPAC name is 3-(2-acetyl-5-methylphenyl)-2-methylimino-1,3-thiazolidin-4-one;N-[(E)-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]methylideneamino]methanethioamide.
| Compound Name | 3-(2-acetyl-5-methylphenyl)-2-methylimino-1,3-thiazolidin-4-one;N-[(E)-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]methylideneamino]methanethioamide |
|---|---|
| PubChem CID | 142320674 |
| Molecular Formula | C30H26F3N7O3S2 |
| Molecular Weight | 653.71 g/mol |
| Exact Mass | 653.15 |
| IUPAC Name | 3-(2-acetyl-5-methylphenyl)-2-methylimino-1,3-thiazolidin-4-one;N-[(E)-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]methylideneamino]methanethioamide |
| SMILES | C/N=C1\SCC(=O)N1c1cc(C)ccc1C(C)=O.FC(F)(F)Oc1ccc(-n2cnc(-c3ccc(/C=N/NC=S)cc3)n2)cc1 |
| InChI | InChI=1S/C17H12F3N5OS.C13H14N2O2S/c18-17(19,20)26-15-7-5-14(6-8-15)25-10-21-16(24-25)13-3-1-12(2-4-13)9-22-23-11-27;1-8-4-5-10(9(2)16)11(6-8)15-12(17)7-18-13(15)14-3/h1-11H,(H,23,27);4-6H,7H2,1-3H3/b22-9+;14-13- |
| InChIKey | HEDOHLSXTZXIRR-ASRCYIDTSA-N |
| XLogP | 5.98 |
| TPSA | 114.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.71 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|