C23H26BBrFN5O5 — CID 142330591
N'-(3-bromo-4-fluorophenyl)-N-hydroxy-4-[2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]ethylamino]-1,2,5-oxadiazole-3-carboximidamide (PubChem CID 142330591) has the molecular formula C23H26BBrFN5O5 and a molecular weight of 562.21 g/mol. Its IUPAC name is N'-(3-bromo-4-fluorophenyl)-N-hydroxy-4-[2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]ethylamino]-1,2,5-oxadiazole-3-carboximidamide.
| Compound Name | N'-(3-bromo-4-fluorophenyl)-N-hydroxy-4-[2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]ethylamino]-1,2,5-oxadiazole-3-carboximidamide |
|---|---|
| PubChem CID | 142330591 |
| Molecular Formula | C23H26BBrFN5O5 |
| Molecular Weight | 562.21 g/mol |
| Exact Mass | 561.12 |
| IUPAC Name | N'-(3-bromo-4-fluorophenyl)-N-hydroxy-4-[2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]ethylamino]-1,2,5-oxadiazole-3-carboximidamide |
| SMILES | CC1(C)OB(c2ccc(OCCNc3nonc3/C(=N/c3ccc(F)c(Br)c3)NO)cc2)OC1(C)C |
| InChI | InChI=1S/C23H26BBrFN5O5/c1-22(2)23(3,4)35-24(34-22)14-5-8-16(9-6-14)33-12-11-27-20-19(30-36-31-20)21(29-32)28-15-7-10-18(26)17(25)13-15/h5-10,13,32H,11-12H2,1-4H3,(H,27,31)(H,28,29) |
| InChIKey | LVQFXGDNCHOVLC-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 123.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.21 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|