C23H35IN11OP — CID 142334174
N'-[amino(methyl)amino]-3-[[5-[[(1E,3Z)-1,4-diaminopenta-1,3-dienyl]amino]-3-iodophosphanyl-2-methylimidazo[4,5-b]pyridin-7-yl]amino]-2-methoxybenzenecarboximidamide;ethane (PubChem CID 142334174) has the molecular formula C23H35IN11OP and a molecular weight of 639.49 g/mol. Its IUPAC name is N'-[amino(methyl)amino]-3-[[5-[[(1E,3Z)-1,4-diaminopenta-1,3-dienyl]amino]-3-iodophosphanyl-2-methylimidazo[4,5-b]pyridin-7-yl]amino]-2-methoxybenzenecarboximidamide;ethane.
| Compound Name | N'-[amino(methyl)amino]-3-[[5-[[(1E,3Z)-1,4-diaminopenta-1,3-dienyl]amino]-3-iodophosphanyl-2-methylimidazo[4,5-b]pyridin-7-yl]amino]-2-methoxybenzenecarboximidamide;ethane |
|---|---|
| PubChem CID | 142334174 |
| Molecular Formula | C23H35IN11OP |
| Molecular Weight | 639.49 g/mol |
| Exact Mass | 639.18 |
| IUPAC Name | N'-[amino(methyl)amino]-3-[[5-[[(1E,3Z)-1,4-diaminopenta-1,3-dienyl]amino]-3-iodophosphanyl-2-methylimidazo[4,5-b]pyridin-7-yl]amino]-2-methoxybenzenecarboximidamide;ethane |
| SMILES | CC.COc1c(Nc2cc(N/C(N)=C/C=C(/C)N)nc3c2nc(C)n3PI)cccc1/C(N)=N/N(C)N |
| InChI | InChI=1S/C21H29IN11OP.C2H6/c1-11(23)8-9-16(24)29-17-10-15(18-21(30-17)33(35-22)12(2)27-18)28-14-7-5-6-13(19(14)34-4)20(25)31-32(3)26;1-2/h5-10,35H,23-24,26H2,1-4H3,(H2,25,31)(H2,28,29,30);1-2H3/b11-8-,16-9+; |
| InChIKey | BDBOAGJRDAIDTE-VXJKTSIRSA-N |
| XLogP | 3.81 |
| TPSA | 183.68 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.49 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|