C23H34N4O3 — CID 142338235
tert-butyl 4-[(NE)-N'-methyl-N-[1-[3-(oxolan-2-yl)phenyl]ethylidene]carbamimidoyl]piperazine-1-carboxylate (PubChem CID 142338235) has the molecular formula C23H34N4O3 and a molecular weight of 414.55 g/mol. Its IUPAC name is tert-butyl 4-[(NE)-N'-methyl-N-[1-[3-(oxolan-2-yl)phenyl]ethylidene]carbamimidoyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[(NE)-N'-methyl-N-[1-[3-(oxolan-2-yl)phenyl]ethylidene]carbamimidoyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 142338235 |
| Molecular Formula | C23H34N4O3 |
| Molecular Weight | 414.55 g/mol |
| Exact Mass | 414.26 |
| IUPAC Name | tert-butyl 4-[(NE)-N'-methyl-N-[1-[3-(oxolan-2-yl)phenyl]ethylidene]carbamimidoyl]piperazine-1-carboxylate |
| SMILES | C/N=C(/N=C(\C)c1cccc(C2CCCO2)c1)N1CCN(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C23H34N4O3/c1-17(18-8-6-9-19(16-18)20-10-7-15-29-20)25-21(24-5)26-11-13-27(14-12-26)22(28)30-23(2,3)4/h6,8-9,16,20H,7,10-15H2,1-5H3/b24-21-,25-17+ |
| InChIKey | OAEJYRBOHVYWMA-ZTGDYWFSSA-N |
| XLogP | 3.89 |
| TPSA | 66.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.55 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|