C23H33N5O3S — CID 142338269
4-[3-[4-methanimidoyl-3-(oxetan-3-ylamino)phenyl]-1,2,4-thiadiazol-5-yl]piperidine-1-carbaldehyde;2-methoxy-2-methylpropane (PubChem CID 142338269) has the molecular formula C23H33N5O3S and a molecular weight of 459.62 g/mol. Its IUPAC name is 4-[3-[4-methanimidoyl-3-(oxetan-3-ylamino)phenyl]-1,2,4-thiadiazol-5-yl]piperidine-1-carbaldehyde;2-methoxy-2-methylpropane.
| Compound Name | 4-[3-[4-methanimidoyl-3-(oxetan-3-ylamino)phenyl]-1,2,4-thiadiazol-5-yl]piperidine-1-carbaldehyde;2-methoxy-2-methylpropane |
|---|---|
| PubChem CID | 142338269 |
| Molecular Formula | C23H33N5O3S |
| Molecular Weight | 459.62 g/mol |
| Exact Mass | 459.23 |
| IUPAC Name | 4-[3-[4-methanimidoyl-3-(oxetan-3-ylamino)phenyl]-1,2,4-thiadiazol-5-yl]piperidine-1-carbaldehyde;2-methoxy-2-methylpropane |
| SMILES | COC(C)(C)C.[H]/N=C/c1ccc(-c2nsc(C3CCN(C=O)CC3)n2)cc1NC1COC1 |
| InChI | InChI=1S/C18H21N5O2S.C5H12O/c19-8-14-2-1-13(7-16(14)20-15-9-25-10-15)17-21-18(26-22-17)12-3-5-23(11-24)6-4-12;1-5(2,3)6-4/h1-2,7-8,11-12,15,19-20H,3-6,9-10H2;1-4H3/b19-8+; |
| InChIKey | VHHCPJMZSPGTIX-BTSUEJIHSA-N |
| XLogP | 3.78 |
| TPSA | 100.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.62 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|