C9H17NS — CID 142338282
[(Z)-2,5-dimethylhex-3-en-2-yl] methanimidothioate (PubChem CID 142338282) has the molecular formula C9H17NS and a molecular weight of 171.31 g/mol. Its IUPAC name is [(Z)-2,5-dimethylhex-3-en-2-yl] methanimidothioate.
| Compound Name | [(Z)-2,5-dimethylhex-3-en-2-yl] methanimidothioate |
|---|---|
| PubChem CID | 142338282 |
| Molecular Formula | C9H17NS |
| Molecular Weight | 171.31 g/mol |
| Exact Mass | 171.11 |
| IUPAC Name | [(Z)-2,5-dimethylhex-3-en-2-yl] methanimidothioate |
| SMILES | [H]/N=C/SC(C)(C)/C=C\C(C)C |
| InChI | InChI=1S/C9H17NS/c1-8(2)5-6-9(3,4)11-7-10/h5-8,10H,1-4H3/b6-5-,10-7+ |
| InChIKey | WTKNYNLIBUUECD-ZZWPSLBBSA-N |
| XLogP | 3.32 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.31 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|