C18H23FN2O4 — CID 142348218
tert-butyl 3-(3-fluoro-4-methoxyphenyl)-3-[5-(hydroxymethyl)-1H-pyrazol-3-yl]propanoate (PubChem CID 142348218) has the molecular formula C18H23FN2O4 and a molecular weight of 350.39 g/mol. Its IUPAC name is tert-butyl 3-(3-fluoro-4-methoxyphenyl)-3-[5-(hydroxymethyl)-1H-pyrazol-3-yl]propanoate.
| Compound Name | tert-butyl 3-(3-fluoro-4-methoxyphenyl)-3-[5-(hydroxymethyl)-1H-pyrazol-3-yl]propanoate |
|---|---|
| PubChem CID | 142348218 |
| Molecular Formula | C18H23FN2O4 |
| Molecular Weight | 350.39 g/mol |
| Exact Mass | 350.16 |
| IUPAC Name | tert-butyl 3-(3-fluoro-4-methoxyphenyl)-3-[5-(hydroxymethyl)-1H-pyrazol-3-yl]propanoate |
| SMILES | COc1ccc(C(CC(=O)OC(C)(C)C)c2cc(CO)[nH]n2)cc1F |
| InChI | InChI=1S/C18H23FN2O4/c1-18(2,3)25-17(23)9-13(15-8-12(10-22)20-21-15)11-5-6-16(24-4)14(19)7-11/h5-8,13,22H,9-10H2,1-4H3,(H,20,21) |
| InChIKey | ULUWRYRSWBUNBU-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 84.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.39 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |